Czy istnieje alternatywa Swift dla NSLog (@ „% s”, __PRETTY_FUNCTION__)

W Objective C możesz zarejestrować wywoływaną metodę za pomocą:

NSLog(@"%s", __PRETTY_FUNCTION__)

Zwykle jest to używane z makra rejestrującego.

Chociaż Swift nie obsługuje makr (wydaje mi się), nadal chciałbym użyć ogólnej instrukcji dziennika, która zawiera nazwę funkcji, która została wywołana. Czy to możliwe w Swift?

Aktualizacja: Teraz używam tej globalnej funkcji do logowania, którą można znaleźć tutaj: https://github.com/evermeer/Stuff#print I którą możesz zainstalować za pomocą:

pod 'Stuff/Print'

Oto kod:

public class Stuff {

    public enum logLevel: Int {
        case info = 1
        case debug = 2
        case warn = 3
        case error = 4
        case fatal = 5
        case none = 6

        public func description() -> String {
            switch self {
            case .info:
                return "❓"
            case .debug:
                return "✳️"
            case .warn:
                return "⚠️"
            case .error:
                return "🚫"
            case .fatal:
                return "🆘"
            case .none:
                return ""
            }
        }
    }

    public static var minimumLogLevel: logLevel = .info

    public static func print<T>(_ object: T, _ level: logLevel = .debug, filename: String = #file, line: Int = #line, funcname: String = #function) {
        if level.rawValue >= Stuff.minimumLogLevel.rawValue {
            let dateFormatter = DateFormatter()
            dateFormatter.dateFormat = "MM/dd/yyyy HH:mm:ss:SSS"
            let process = ProcessInfo.processInfo
            let threadId = "?"
            let file = URL(string: filename)?.lastPathComponent ?? ""
            Swift.print("\n\(level.description()) .\(level) ⏱ \(dateFormatter.string(from: Foundation.Date())) 📱 \(process.processName) [\(process.processIdentifier):\(threadId)] 📂 \(file)(\(line)) ⚙️ \(funcname) ➡️\r\t\(object)")
        }
    }
}

Którego możesz użyć w ten sposób:

Stuff.print("Just as the standard print but now with detailed information")
Stuff.print("Now it's a warning", .warn)
Stuff.print("Or even an error", .error)

Stuff.minimumLogLevel = .error
Stuff.print("Now you won't see normal log output")
Stuff.print("Only errors are shown", .error)

Stuff.minimumLogLevel = .none
Stuff.print("Or if it's disabled you won't see any log", .error)    

Co spowoduje:

✳️ .debug ⏱ 02/13/2017 09:52:51:852 📱 xctest [18960:?] 📂 PrintStuffTests.swift(15) ⚙️ testExample() ➡️
    Just as the standard print but now with detailed information

⚠️ .warn ⏱ 02/13/2017 09:52:51:855 📱 xctest [18960:?] 📂 PrintStuffTests.swift(16) ⚙️ testExample() ➡️
    Now it's a warning

🚫 .error ⏱ 02/13/2017 09:52:51:855 📱 xctest [18960:?] 📂 PrintStuffTests.swift(17) ⚙️ testExample() ➡️
    Or even an error

🚫 .error ⏱ 02/13/2017 09:52:51:855 📱 xctest [18960:?] 📂 PrintStuffTests.swift(21) ⚙️ testExample() ➡️
    Only errors are shown

Swift ma #file, #function, #line i #column. Z języka szybkiego programowania :

#file - String - nazwa pliku, w którym się pojawia.

#line - Int - numer wiersza, w którym się pojawia.

#column - Int - numer kolumny, w której się zaczyna.

#function - String - nazwa deklaracji, w której występuje.

Począwszy od Swift 2.2 powinniśmy użyć:

• #file (String) Nazwa pliku, w którym się pojawia.
• #line (Int) Numer wiersza, w którym się pojawia.
• #column (Int) Numer kolumny, w której się zaczyna.
• #function (String) Nazwa deklaracji, w której występuje.

Z języka programowania Swift (Swift 3.1) na stronie 894.

func specialLiterals() {
    print("#file literal from file: \(#file)")
    print("#function literal from function: \(#function)")
    print("#line: \(#line) -> #column: \(#column)")
}
// Output:
// #file literal from file: My.playground
// #function literal from function: specialLiterals()
// #line: 10 -> #column: 42

Swift 4
Oto moje podejście:

func pretty_function(_ file: String = #file, function: String = #function, line: Int = #line) {

    let fileString: NSString = NSString(string: file)

    if Thread.isMainThread {
        print("file:\(fileString.lastPathComponent) function:\(function) line:\(line) [M]")
    } else {
        print("file:\(fileString.lastPathComponent) function:\(function) line:\(line) [T]")
    }
}

Ustaw tę funkcję jako globalną i po prostu wywołaj

pretty_function()

Bonus: Zobaczysz, że wątek jest wykonywany, [T] dla wątku w tle i [M] dla wątku głównego.

Począwszy od XCode beta 6, możesz użyć reflect(self).summarydo uzyskania nazwy klasy i __FUNCTION__nazwy funkcji, ale w tej chwili sytuacja jest nieco zniekształcona. Miejmy nadzieję, że znajdą lepsze rozwiązanie. Warto użyć #define, dopóki nie wyjdziemy z wersji beta.

Ten kod:

NSLog("[%@ %@]", reflect(self).summary, __FUNCTION__)

daje takie wyniki:

2014-08-24 08:46:26.606 SwiftLessons[427:16981938] [C12SwiftLessons24HelloWorldViewController (has 2 children) goodbyeActiongoodbyeAction]

EDYCJA: To jest więcej kodu, ale zbliżyło mnie do tego, czego potrzebowałem, a myślę, że właśnie tego chciałeś.

func intFromString(str: String) -> Int
{
    var result = 0;
    for chr in str.unicodeScalars
    {
        if (chr.isDigit())
        {
            let value = chr - "0";
            result *= 10;
            result += value;
        }
        else
        {
            break;
        }
    }

    return result;
}


@IBAction func flowAction(AnyObject)
{
    let cname = _stdlib_getTypeName(self)
    var parse = cname.substringFromIndex(1)                                 // strip off the "C"
    var count = self.intFromString(parse)
    var countStr = String(format: "%d", count)                              // get the number at the beginning
    parse = parse.substringFromIndex(countStr.lengthOfBytesUsingEncoding(NSUTF8StringEncoding))
    let appName = parse.substringToIndex(count)                             // pull the app name

    parse = parse.substringFromIndex(count);                                // now get the class name
    count = self.intFromString(parse)
    countStr = String(format: "%d", count)
    parse = parse.substringFromIndex(countStr.lengthOfBytesUsingEncoding(NSUTF8StringEncoding))
    let className = parse.substringToIndex(count)
    NSLog("app: %@ class: %@ func: %@", appName, className, __FUNCTION__)
}

Daje takie wyjście:

2014-08-24 09:52:12.159 SwiftLessons[1397:17145716] app: SwiftLessons class: ViewController func: flowAction

Wolę zdefiniować funkcję dziennika globalnego:

[Swift 3.1]

func ZYLog(_ object: Any?, filename: String = #file, line: Int = #line, funcname: String = #function) {
    #if DEBUG
    print("****\(Date()) \(filename)(\(line)) \(funcname):\r\(object ?? "nil")\n")
    #endif
}

[Swift 3.0]

func ZYLog<T>(_ object: T?, filename: String = #file, line: Int = #line, funcname: String = #function) {
    #if DEBUG
    print("****\(Date()) \(filename)(\(line)) \(funcname):\r\(object)\n")
    #endif
}

[Swift 2.0]

func ZYLog<T>(object: T, filename: String = __FILE__, line: Int = __LINE__, funcname: String = __FUNCTION__) {
    println("****\(filename.lastPathComponent)(\(line)) \(funcname):\r\(object)\n")
}

wynik jest podobny do:

****ZYHttpSessionManager.swift(78) POST(_:parameters:success:failure:):
[POST] user/login, {
    "auth_key" = xxx;
    "auth_type" = 0;
    pwd = xxx;
    user = "xxx";
}

****PointViewController.swift(162) loadData():
review/list [limit: 30, skip: 0]

****ZYHttpSessionManager.swift(66) GET(_:parameters:success:failure:):
[GET] review/list, {
    "auth_key" = xxx;
    uuid = "xxx";
}

Oto zaktualizowana odpowiedź Swift 2.

func LogW(msg:String, function: String = __FUNCTION__, file: String = __FILE__, line: Int = __LINE__){
    print("[WARNING]\(makeTag(function, file: file, line: line)) : \(msg)")
}

private func makeTag(function: String, file: String, line: Int) -> String{
    let url = NSURL(fileURLWithPath: file)
    let className:String! = url.lastPathComponent == nil ? file: url.lastPathComponent!
    return "\(className) \(function)[\(line)]"
}

Przykład użycia:

LogW("Socket connection error: \(error)")

Lub niewielka modyfikacja funkcji za pomocą:

func logFunctionName(file:String = __FILE__, fnc:String = __FUNCTION__, line:(Int)=__LINE__) {
    var className = file.lastPathComponent.componentsSeparatedByString(".")
    println("\(className[0]):\(fnc):\(line)")

}

/ * wygeneruje ślad wykonania, taki jak: AppDelegate: application (_: didFinishLaunchingWithOptions :): 18 Product: init (typ: nazwa: rok: cena :): 34 FirstViewController: viewDidLoad (): 15 AppDelegate: applicationDidBecomeActive: 62 * /

Używam, to wszystko, co jest wymagane w pliku swift, wszystkie inne pliki będą go odbierać (jako funkcja globalna). Jeśli chcesz zwolnić aplikację, po prostu zakomentuj linię.

import UIKit

func logFunctionName(file:NSString = __FILE__, fnc:String = __FUNCTION__){  
    println("\(file.lastPathComponent):\(fnc)")
}

Swift 3.0

public func LogFunction<T>(object: T, filename: String = #file, line: Int = #line, funcname: String = #function) {
    let dateFormatter = DateFormatter()
    dateFormatter.dateFormat = "MM/dd/yyyy HH:mm:ss:SSS"
    let process = ProcessInfo.processInfo()
    let threadId = "?"
    print("\(dateFormatter.string(from:Date())) \(process.processName) [\(process.processIdentifier):\(threadId)] \(filename)(\(line)) \(funcname)::: \(object)")
}

Swift 3.x +

Jeśli nie chcesz pełnej nazwy pliku, oto szybka poprawka.

func trace(fileName:String = #file, lineNumber:Int = #line, functionName:String = #function) -> Void {
    print("filename: \(fileName.components(separatedBy: "/").last!) function: \(functionName) line: #\(lineNumber)")
}

filename: ViewController.swift function: viewDidLoad() line: #42

Inny sposób rejestrowania wywołań funkcji:

NSLog("\(type(of:self)): %@", #function)